C20H36N4O3S — CID 45189550
4-[[1-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]piperidin-3-yl]methyl]morpholine (PubChem CID 45189550) has the molecular formula C20H36N4O3S and a molecular weight of 412.60 g/mol. Its IUPAC name is 4-[[1-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]piperidin-3-yl]methyl]morpholine.
| Compound Name | 4-[[1-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]piperidin-3-yl]methyl]morpholine |
|---|---|
| PubChem CID | 45189550 |
| Molecular Formula | C20H36N4O3S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 4-[[1-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]piperidin-3-yl]methyl]morpholine |
| SMILES | CCCCn1c(CN2CCCC(CN3CCOCC3)C2)cnc1S(=O)(=O)CC |
| InChI | InChI=1S/C20H36N4O3S/c1-3-5-9-24-19(14-21-20(24)28(25,26)4-2)17-23-8-6-7-18(16-23)15-22-10-12-27-13-11-22/h14,18H,3-13,15-17H2,1-2H3 |
| InChIKey | OWYFKKHHDKBCFX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |