About 1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-(thiolan-3-yl)piperidin-4-amine
1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-(thiolan-3-yl)piperidin-4-amine (PubChem CID 45189824) has the molecular formula C19H25N3S2
and a molecular weight of 359.56 g/mol. Its IUPAC name is 1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-(thiolan-3-yl)piperidin-4-amine.
Molecular Properties
| Compound Name | 1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-(thiolan-3-yl)piperidin-4-amine |
| PubChem CID | 45189824 |
| Molecular Formula | C19H25N3S2 |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-(thiolan-3-yl)piperidin-4-amine |
| SMILES | Cc1nc(-c2cccc(N3CCC(NC4CCSC4)CC3)c2)cs1 |
| InChI | InChI=1S/C19H25N3S2/c1-14-20-19(13-24-14)15-3-2-4-18(11-15)22-8-5-16(6-9-22)21-17-7-10-23-12-17/h2-4,11,13,16-17,21H,5-10,12H2,1H3 |
| InChIKey | ZRGQCFYWQMQPNW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-(thiolan-3-yl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-(thiolan-3-yl)piperidin-4-amine?
The IUPAC name of 1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-(thiolan-3-yl)piperidin-4-amine (CID 45189824) is 1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-(thiolan-3-yl)piperidin-4-amine.
What is the SMILES notation for 1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-(thiolan-3-yl)piperidin-4-amine?
The canonical SMILES for 1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-(thiolan-3-yl)piperidin-4-amine is Cc1nc(-c2cccc(N3CCC(NC4CCSC4)CC3)c2)cs1.
What is the InChIKey of 1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-(thiolan-3-yl)piperidin-4-amine?
The InChIKey is ZRGQCFYWQMQPNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3S2/c1-14-20-19(13-24-14)15-3-2-4-18(11-15)22-8-5-16(6-9-22)21-17-7-10-23-12-17/h2-4,11,13,16-17,21H,5-10,12H2,1H3.
What are the key properties of 1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-(thiolan-3-yl)piperidin-4-amine?
1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-(thiolan-3-yl)piperidin-4-amine has a molecular weight of 359.56 g/mol, XLogP of 4.18, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-N-(thiolan-3-yl)piperidin-4-amine is sourced from PubChem (CID 45189824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).