C23H22F3N3O — CID 45189876
N-(6,6-dimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-yl)-2-(2,3,6-trifluorophenyl)acetamide (PubChem CID 45189876) has the molecular formula C23H22F3N3O and a molecular weight of 413.44 g/mol. Its IUPAC name is N-(6,6-dimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-yl)-2-(2,3,6-trifluorophenyl)acetamide.
| Compound Name | N-(6,6-dimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-yl)-2-(2,3,6-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 45189876 |
| Molecular Formula | C23H22F3N3O |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N-(6,6-dimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-yl)-2-(2,3,6-trifluorophenyl)acetamide |
| SMILES | CC1(C)Cc2c(cnn2-c2ccccc2)C(NC(=O)Cc2c(F)ccc(F)c2F)C1 |
| InChI | InChI=1S/C23H22F3N3O/c1-23(2)11-19(28-21(30)10-15-17(24)8-9-18(25)22(15)26)16-13-27-29(20(16)12-23)14-6-4-3-5-7-14/h3-9,13,19H,10-12H2,1-2H3,(H,28,30) |
| InChIKey | PTBJVUPPLDGPKC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|