C19H20FNOS — CID 4519038
2-(4-tert-butylphenyl)-3-(4-fluorophenyl)-1,3-thiazolidin-4-one (PubChem CID 4519038) has the molecular formula C19H20FNOS and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-3-(4-fluorophenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-tert-butylphenyl)-3-(4-fluorophenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4519038 |
| Molecular Formula | C19H20FNOS |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-(4-tert-butylphenyl)-3-(4-fluorophenyl)-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)c1ccc(C2SCC(=O)N2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H20FNOS/c1-19(2,3)14-6-4-13(5-7-14)18-21(17(22)12-23-18)16-10-8-15(20)9-11-16/h4-11,18H,12H2,1-3H3 |
| InChIKey | HKWAKMYFZXHWOO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |