C25H27N3O4 — CID 45190692
5-[1-(2,3-dihydro-1-benzofuran-2-carbonyl)piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 45190692) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 5-[1-(2,3-dihydro-1-benzofuran-2-carbonyl)piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[1-(2,3-dihydro-1-benzofuran-2-carbonyl)piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45190692 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 5-[1-(2,3-dihydro-1-benzofuran-2-carbonyl)piperidin-4-yl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CCc2ccccc2)(C2CCN(C(=O)C3Cc4ccccc4O3)CC2)N1 |
| InChI | InChI=1S/C25H27N3O4/c29-22(21-16-18-8-4-5-9-20(18)32-21)28-14-11-19(12-15-28)25(23(30)26-24(31)27-25)13-10-17-6-2-1-3-7-17/h1-9,19,21H,10-16H2,(H2,26,27,30,31) |
| InChIKey | FUPPHHHCOXOCLA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|