About N-cyclohexyl-N,4-dimethyl-5-[1-[(1-methylpyrazol-4-yl)methylamino]ethyl]pyrimidin-2-amine
N-cyclohexyl-N,4-dimethyl-5-[1-[(1-methylpyrazol-4-yl)methylamino]ethyl]pyrimidin-2-amine (PubChem CID 45190775) has the molecular formula C19H30N6
and a molecular weight of 342.49 g/mol. Its IUPAC name is N-cyclohexyl-N,4-dimethyl-5-[1-[(1-methylpyrazol-4-yl)methylamino]ethyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-N,4-dimethyl-5-[1-[(1-methylpyrazol-4-yl)methylamino]ethyl]pyrimidin-2-amine |
| PubChem CID | 45190775 |
| Molecular Formula | C19H30N6 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | N-cyclohexyl-N,4-dimethyl-5-[1-[(1-methylpyrazol-4-yl)methylamino]ethyl]pyrimidin-2-amine |
| SMILES | Cc1nc(N(C)C2CCCCC2)ncc1C(C)NCc1cnn(C)c1 |
| InChI | InChI=1S/C19H30N6/c1-14(20-10-16-11-22-24(3)13-16)18-12-21-19(23-15(18)2)25(4)17-8-6-5-7-9-17/h11-14,17,20H,5-10H2,1-4H3 |
| InChIKey | AQSCGCZFJDMJPO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-cyclohexyl-N,4-dimethyl-5-[1-[(1-methylpyrazol-4-yl)methylamino]ethyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N,4-dimethyl-5-[1-[(1-methylpyrazol-4-yl)methylamino]ethyl]pyrimidin-2-amine?
The IUPAC name of N-cyclohexyl-N,4-dimethyl-5-[1-[(1-methylpyrazol-4-yl)methylamino]ethyl]pyrimidin-2-amine (CID 45190775) is N-cyclohexyl-N,4-dimethyl-5-[1-[(1-methylpyrazol-4-yl)methylamino]ethyl]pyrimidin-2-amine.
What is the SMILES notation for N-cyclohexyl-N,4-dimethyl-5-[1-[(1-methylpyrazol-4-yl)methylamino]ethyl]pyrimidin-2-amine?
The canonical SMILES for N-cyclohexyl-N,4-dimethyl-5-[1-[(1-methylpyrazol-4-yl)methylamino]ethyl]pyrimidin-2-amine is Cc1nc(N(C)C2CCCCC2)ncc1C(C)NCc1cnn(C)c1.
What is the InChIKey of N-cyclohexyl-N,4-dimethyl-5-[1-[(1-methylpyrazol-4-yl)methylamino]ethyl]pyrimidin-2-amine?
The InChIKey is AQSCGCZFJDMJPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N6/c1-14(20-10-16-11-22-24(3)13-16)18-12-21-19(23-15(18)2)25(4)17-8-6-5-7-9-17/h11-14,17,20H,5-10H2,1-4H3.
What are the key properties of N-cyclohexyl-N,4-dimethyl-5-[1-[(1-methylpyrazol-4-yl)methylamino]ethyl]pyrimidin-2-amine?
N-cyclohexyl-N,4-dimethyl-5-[1-[(1-methylpyrazol-4-yl)methylamino]ethyl]pyrimidin-2-amine has a molecular weight of 342.49 g/mol, XLogP of 3.14, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N,4-dimethyl-5-[1-[(1-methylpyrazol-4-yl)methylamino]ethyl]pyrimidin-2-amine is sourced from PubChem (CID 45190775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).