C25H30ClN5O2 — CID 45192151
7-chloro-2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-N-(oxolan-2-ylmethyl)quinazolin-4-amine (PubChem CID 45192151) has the molecular formula C25H30ClN5O2 and a molecular weight of 468.00 g/mol. Its IUPAC name is 7-chloro-2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-N-(oxolan-2-ylmethyl)quinazolin-4-amine.
| Compound Name | 7-chloro-2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-N-(oxolan-2-ylmethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 45192151 |
| Molecular Formula | C25H30ClN5O2 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 7-chloro-2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-N-(oxolan-2-ylmethyl)quinazolin-4-amine |
| SMILES | COc1ccc(N2CCN(Cc3nc(NCC4CCCO4)c4ccc(Cl)cc4n3)CC2)cc1 |
| InChI | InChI=1S/C25H30ClN5O2/c1-32-20-7-5-19(6-8-20)31-12-10-30(11-13-31)17-24-28-23-15-18(26)4-9-22(23)25(29-24)27-16-21-3-2-14-33-21/h4-9,15,21H,2-3,10-14,16-17H2,1H3,(H,27,28,29) |
| InChIKey | KQVQOABKVBNMRS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|