C20H20F5NOS — CID 45192302
2-(3,4-difluorophenyl)-8-methoxy-5-(4,4,4-trifluorobutyl)-3,4-dihydro-2H-1,5-benzothiazepine (PubChem CID 45192302) has the molecular formula C20H20F5NOS and a molecular weight of 417.44 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-8-methoxy-5-(4,4,4-trifluorobutyl)-3,4-dihydro-2H-1,5-benzothiazepine.
| Compound Name | 2-(3,4-difluorophenyl)-8-methoxy-5-(4,4,4-trifluorobutyl)-3,4-dihydro-2H-1,5-benzothiazepine |
|---|---|
| PubChem CID | 45192302 |
| Molecular Formula | C20H20F5NOS |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-(3,4-difluorophenyl)-8-methoxy-5-(4,4,4-trifluorobutyl)-3,4-dihydro-2H-1,5-benzothiazepine |
| SMILES | COc1ccc2c(c1)SC(c1ccc(F)c(F)c1)CCN2CCCC(F)(F)F |
| InChI | InChI=1S/C20H20F5NOS/c1-27-14-4-6-17-19(12-14)28-18(13-3-5-15(21)16(22)11-13)7-10-26(17)9-2-8-20(23,24)25/h3-6,11-12,18H,2,7-10H2,1H3 |
| InChIKey | RZXANPFPQLHKLK-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|