C22H25N3O3S — CID 45192403
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperidin-3-amine (PubChem CID 45192403) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperidin-3-amine.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 45192403 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]piperidin-3-amine |
| SMILES | Cc1oc(-c2cccs2)nc1CN1CCCC(Nc2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C22H25N3O3S/c1-15-18(24-22(28-15)21-5-3-11-29-21)14-25-8-2-4-17(13-25)23-16-6-7-19-20(12-16)27-10-9-26-19/h3,5-7,11-12,17,23H,2,4,8-10,13-14H2,1H3 |
| InChIKey | CSRBQAUBBXRRDM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|