C11H10N2O3 — CID 4519264
phenyl N-(5-methyl-1,2-oxazol-3-yl)carbamate (PubChem CID 4519264) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is phenyl N-(5-methyl-1,2-oxazol-3-yl)carbamate.
| Compound Name | phenyl N-(5-methyl-1,2-oxazol-3-yl)carbamate |
|---|---|
| PubChem CID | 4519264 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | phenyl N-(5-methyl-1,2-oxazol-3-yl)carbamate |
| SMILES | Cc1cc(NC(=O)Oc2ccccc2)no1 |
| InChI | InChI=1S/C11H10N2O3/c1-8-7-10(13-16-8)12-11(14)15-9-5-3-2-4-6-9/h2-7H,1H3,(H,12,13,14) |
| InChIKey | AOXNEYUOJSRBSQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |