C23H24ClN3O2S — CID 45192877
6-[(5-chloro-2-hydroxyphenyl)methyl]-N-(2-methyl-1,3-benzothiazol-5-yl)-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 45192877) has the molecular formula C23H24ClN3O2S and a molecular weight of 441.98 g/mol. Its IUPAC name is 6-[(5-chloro-2-hydroxyphenyl)methyl]-N-(2-methyl-1,3-benzothiazol-5-yl)-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | 6-[(5-chloro-2-hydroxyphenyl)methyl]-N-(2-methyl-1,3-benzothiazol-5-yl)-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 45192877 |
| Molecular Formula | C23H24ClN3O2S |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 6-[(5-chloro-2-hydroxyphenyl)methyl]-N-(2-methyl-1,3-benzothiazol-5-yl)-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | Cc1nc2cc(NC(=O)C3CC34CCN(Cc3cc(Cl)ccc3O)CC4)ccc2s1 |
| InChI | InChI=1S/C23H24ClN3O2S/c1-14-25-19-11-17(3-5-21(19)30-14)26-22(29)18-12-23(18)6-8-27(9-7-23)13-15-10-16(24)2-4-20(15)28/h2-5,10-11,18,28H,6-9,12-13H2,1H3,(H,26,29) |
| InChIKey | FVSQBZJNHCRBLM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|