About 2-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-6-piperidin-4-ylpyrimidin-4-amine
2-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-6-piperidin-4-ylpyrimidin-4-amine (PubChem CID 45193824) has the molecular formula C20H23N5O
and a molecular weight of 349.44 g/mol. Its IUPAC name is 2-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-6-piperidin-4-ylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-6-piperidin-4-ylpyrimidin-4-amine |
| PubChem CID | 45193824 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 2-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-6-piperidin-4-ylpyrimidin-4-amine |
| SMILES | Cc1nc(NCc2coc(-c3ccccc3)n2)cc(C2CCNCC2)n1 |
| InChI | InChI=1S/C20H23N5O/c1-14-23-18(15-7-9-21-10-8-15)11-19(24-14)22-12-17-13-26-20(25-17)16-5-3-2-4-6-16/h2-6,11,13,15,21H,7-10,12H2,1H3,(H,22,23,24) |
| InChIKey | MOUHOVVIRMRBQW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-6-piperidin-4-ylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-6-piperidin-4-ylpyrimidin-4-amine?
The IUPAC name of 2-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-6-piperidin-4-ylpyrimidin-4-amine (CID 45193824) is 2-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-6-piperidin-4-ylpyrimidin-4-amine.
What is the SMILES notation for 2-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-6-piperidin-4-ylpyrimidin-4-amine?
The canonical SMILES for 2-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-6-piperidin-4-ylpyrimidin-4-amine is Cc1nc(NCc2coc(-c3ccccc3)n2)cc(C2CCNCC2)n1.
What is the InChIKey of 2-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-6-piperidin-4-ylpyrimidin-4-amine?
The InChIKey is MOUHOVVIRMRBQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N5O/c1-14-23-18(15-7-9-21-10-8-15)11-19(24-14)22-12-17-13-26-20(25-17)16-5-3-2-4-6-16/h2-6,11,13,15,21H,7-10,12H2,1H3,(H,22,23,24).
What are the key properties of 2-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-6-piperidin-4-ylpyrimidin-4-amine?
2-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-6-piperidin-4-ylpyrimidin-4-amine has a molecular weight of 349.44 g/mol, XLogP of 3.52, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]-6-piperidin-4-ylpyrimidin-4-amine is sourced from PubChem (CID 45193824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).