About 2-[1-(2,2-dimethylpropyl)-4-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperazin-2-yl]ethanol
2-[1-(2,2-dimethylpropyl)-4-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperazin-2-yl]ethanol (PubChem CID 45194198) has the molecular formula C18H34N4O
and a molecular weight of 322.50 g/mol. Its IUPAC name is 2-[1-(2,2-dimethylpropyl)-4-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperazin-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[1-(2,2-dimethylpropyl)-4-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperazin-2-yl]ethanol |
| PubChem CID | 45194198 |
| Molecular Formula | C18H34N4O |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | 2-[1-(2,2-dimethylpropyl)-4-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperazin-2-yl]ethanol |
| SMILES | CCc1nc(CN2CCN(CC(C)(C)C)C(CCO)C2)c(C)[nH]1 |
| InChI | InChI=1S/C18H34N4O/c1-6-17-19-14(2)16(20-17)12-21-8-9-22(13-18(3,4)5)15(11-21)7-10-23/h15,23H,6-13H2,1-5H3,(H,19,20) |
| InChIKey | PZWWUTXWZQCCFH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-(2,2-dimethylpropyl)-4-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperazin-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2,2-dimethylpropyl)-4-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperazin-2-yl]ethanol?
The IUPAC name of 2-[1-(2,2-dimethylpropyl)-4-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperazin-2-yl]ethanol (CID 45194198) is 2-[1-(2,2-dimethylpropyl)-4-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperazin-2-yl]ethanol.
What is the SMILES notation for 2-[1-(2,2-dimethylpropyl)-4-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperazin-2-yl]ethanol?
The canonical SMILES for 2-[1-(2,2-dimethylpropyl)-4-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperazin-2-yl]ethanol is CCc1nc(CN2CCN(CC(C)(C)C)C(CCO)C2)c(C)[nH]1.
What is the InChIKey of 2-[1-(2,2-dimethylpropyl)-4-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperazin-2-yl]ethanol?
The InChIKey is PZWWUTXWZQCCFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34N4O/c1-6-17-19-14(2)16(20-17)12-21-8-9-22(13-18(3,4)5)15(11-21)7-10-23/h15,23H,6-13H2,1-5H3,(H,19,20).
What are the key properties of 2-[1-(2,2-dimethylpropyl)-4-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperazin-2-yl]ethanol?
2-[1-(2,2-dimethylpropyl)-4-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperazin-2-yl]ethanol has a molecular weight of 322.50 g/mol, XLogP of 2.20, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,2-dimethylpropyl)-4-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperazin-2-yl]ethanol is sourced from PubChem (CID 45194198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).