C22H25ClF3N3O — CID 45194918
2-chloro-N-methyl-N-[[1-[2-[3-(trifluoromethyl)phenyl]ethyl]piperidin-3-yl]methyl]pyridine-4-carboxamide (PubChem CID 45194918) has the molecular formula C22H25ClF3N3O and a molecular weight of 439.91 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-[[1-[2-[3-(trifluoromethyl)phenyl]ethyl]piperidin-3-yl]methyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-methyl-N-[[1-[2-[3-(trifluoromethyl)phenyl]ethyl]piperidin-3-yl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 45194918 |
| Molecular Formula | C22H25ClF3N3O |
| Molecular Weight | 439.91 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2-chloro-N-methyl-N-[[1-[2-[3-(trifluoromethyl)phenyl]ethyl]piperidin-3-yl]methyl]pyridine-4-carboxamide |
| SMILES | CN(CC1CCCN(CCc2cccc(C(F)(F)F)c2)C1)C(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C22H25ClF3N3O/c1-28(21(30)18-7-9-27-20(23)13-18)14-17-5-3-10-29(15-17)11-8-16-4-2-6-19(12-16)22(24,25)26/h2,4,6-7,9,12-13,17H,3,5,8,10-11,14-15H2,1H3 |
| InChIKey | XWWGVVJPCNDDOV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.91 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|