About 2-methyl-5-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]piperidin-1-yl]pyridazin-3-one
2-methyl-5-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]piperidin-1-yl]pyridazin-3-one (PubChem CID 45195583) has the molecular formula C15H23F3N4O
and a molecular weight of 332.37 g/mol. Its IUPAC name is 2-methyl-5-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]piperidin-1-yl]pyridazin-3-one.
Molecular Properties
| Compound Name | 2-methyl-5-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]piperidin-1-yl]pyridazin-3-one |
| PubChem CID | 45195583 |
| Molecular Formula | C15H23F3N4O |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 2-methyl-5-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]piperidin-1-yl]pyridazin-3-one |
| SMILES | CC(CC(F)(F)F)NCC1CCN(c2cnn(C)c(=O)c2)CC1 |
| InChI | InChI=1S/C15H23F3N4O/c1-11(8-15(16,17)18)19-9-12-3-5-22(6-4-12)13-7-14(23)21(2)20-10-13/h7,10-12,19H,3-6,8-9H2,1-2H3 |
| InChIKey | AQIAJWSWKVTZQO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-5-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]piperidin-1-yl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]piperidin-1-yl]pyridazin-3-one?
The IUPAC name of 2-methyl-5-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]piperidin-1-yl]pyridazin-3-one (CID 45195583) is 2-methyl-5-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]piperidin-1-yl]pyridazin-3-one.
What is the SMILES notation for 2-methyl-5-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]piperidin-1-yl]pyridazin-3-one?
The canonical SMILES for 2-methyl-5-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]piperidin-1-yl]pyridazin-3-one is CC(CC(F)(F)F)NCC1CCN(c2cnn(C)c(=O)c2)CC1.
What is the InChIKey of 2-methyl-5-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]piperidin-1-yl]pyridazin-3-one?
The InChIKey is AQIAJWSWKVTZQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23F3N4O/c1-11(8-15(16,17)18)19-9-12-3-5-22(6-4-12)13-7-14(23)21(2)20-10-13/h7,10-12,19H,3-6,8-9H2,1-2H3.
What are the key properties of 2-methyl-5-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]piperidin-1-yl]pyridazin-3-one?
2-methyl-5-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]piperidin-1-yl]pyridazin-3-one has a molecular weight of 332.37 g/mol, XLogP of 1.93, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-[4-[(4,4,4-trifluorobutan-2-ylamino)methyl]piperidin-1-yl]pyridazin-3-one is sourced from PubChem (CID 45195583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).