C21H26N4O3 — CID 45197270
methyl 6-[3-[ethyl(pyridin-4-ylmethyl)amino]piperidine-1-carbonyl]pyridine-3-carboxylate (PubChem CID 45197270) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is methyl 6-[3-[ethyl(pyridin-4-ylmethyl)amino]piperidine-1-carbonyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[3-[ethyl(pyridin-4-ylmethyl)amino]piperidine-1-carbonyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 45197270 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | methyl 6-[3-[ethyl(pyridin-4-ylmethyl)amino]piperidine-1-carbonyl]pyridine-3-carboxylate |
| SMILES | CCN(Cc1ccncc1)C1CCCN(C(=O)c2ccc(C(=O)OC)cn2)C1 |
| InChI | InChI=1S/C21H26N4O3/c1-3-24(14-16-8-10-22-11-9-16)18-5-4-12-25(15-18)20(26)19-7-6-17(13-23-19)21(27)28-2/h6-11,13,18H,3-5,12,14-15H2,1-2H3 |
| InChIKey | XZSADMSGTZNWSD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |