C13H7F3N6 — CID 45197545
3-[3-(trifluoromethyl)phenyl]-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-3,5,7,9,11-pentaene (PubChem CID 45197545) has the molecular formula C13H7F3N6 and a molecular weight of 304.24 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)phenyl]-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-3,5,7,9,11-pentaene.
| Compound Name | 3-[3-(trifluoromethyl)phenyl]-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-3,5,7,9,11-pentaene |
|---|---|
| PubChem CID | 45197545 |
| Molecular Formula | C13H7F3N6 |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 3-[3-(trifluoromethyl)phenyl]-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-3,5,7,9,11-pentaene |
| SMILES | FC(F)(F)c1cccc(-c2nnc3ccc4nncn4n23)c1 |
| InChI | InChI=1S/C13H7F3N6/c14-13(15,16)9-3-1-2-8(6-9)12-20-19-11-5-4-10-18-17-7-21(10)22(11)12/h1-7H |
| InChIKey | HQVWJYPVKZWWJS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |