C22H33N5 — CID 45197766
1-(1-cyclohexylpiperidin-3-yl)-N-(1H-pyrazol-5-ylmethyl)-N-(pyridin-3-ylmethyl)methanamine (PubChem CID 45197766) has the molecular formula C22H33N5 and a molecular weight of 367.54 g/mol. Its IUPAC name is 1-(1-cyclohexylpiperidin-3-yl)-N-(1H-pyrazol-5-ylmethyl)-N-(pyridin-3-ylmethyl)methanamine.
| Compound Name | 1-(1-cyclohexylpiperidin-3-yl)-N-(1H-pyrazol-5-ylmethyl)-N-(pyridin-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 45197766 |
| Molecular Formula | C22H33N5 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | 1-(1-cyclohexylpiperidin-3-yl)-N-(1H-pyrazol-5-ylmethyl)-N-(pyridin-3-ylmethyl)methanamine |
| SMILES | c1cncc(CN(Cc2ccn[nH]2)CC2CCCN(C3CCCCC3)C2)c1 |
| InChI | InChI=1S/C22H33N5/c1-2-8-22(9-3-1)27-13-5-7-20(17-27)16-26(18-21-10-12-24-25-21)15-19-6-4-11-23-14-19/h4,6,10-12,14,20,22H,1-3,5,7-9,13,15-18H2,(H,24,25) |
| InChIKey | BNVBWMNOCRKQKO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |