C27H25FN4O — CID 45197928
4-[[3-[5-(2-fluorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-1-yl]methyl]phenol (PubChem CID 45197928) has the molecular formula C27H25FN4O and a molecular weight of 440.52 g/mol. Its IUPAC name is 4-[[3-[5-(2-fluorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-1-yl]methyl]phenol.
| Compound Name | 4-[[3-[5-(2-fluorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 45197928 |
| Molecular Formula | C27H25FN4O |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 4-[[3-[5-(2-fluorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-1-yl]methyl]phenol |
| SMILES | Oc1ccc(CN2CCCC(c3nc(-c4cccnc4)ncc3-c3ccccc3F)C2)cc1 |
| InChI | InChI=1S/C27H25FN4O/c28-25-8-2-1-7-23(25)24-16-30-27(20-5-3-13-29-15-20)31-26(24)21-6-4-14-32(18-21)17-19-9-11-22(33)12-10-19/h1-3,5,7-13,15-16,21,33H,4,6,14,17-18H2 |
| InChIKey | GJDIENXBXRMBQX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |