C27H24N2O2 — CID 4519819
[4-(2,5-diphenylpyrrol-1-yl)phenyl]-morpholin-4-ylmethanone (PubChem CID 4519819) has the molecular formula C27H24N2O2 and a molecular weight of 408.50 g/mol. Its IUPAC name is [4-(2,5-diphenylpyrrol-1-yl)phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-(2,5-diphenylpyrrol-1-yl)phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 4519819 |
| Molecular Formula | C27H24N2O2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [4-(2,5-diphenylpyrrol-1-yl)phenyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccc(-n2c(-c3ccccc3)ccc2-c2ccccc2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C27H24N2O2/c30-27(28-17-19-31-20-18-28)23-11-13-24(14-12-23)29-25(21-7-3-1-4-8-21)15-16-26(29)22-9-5-2-6-10-22/h1-16H,17-20H2 |
| InChIKey | ACMXBKNVMHWNFN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |