About 2-[(2-oxo-1,3-dihydroindol-3-yl)methyl]-3-phenylquinazolin-4-one
2-[(2-oxo-1,3-dihydroindol-3-yl)methyl]-3-phenylquinazolin-4-one (PubChem CID 4519951) has the molecular formula C23H17N3O2
and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-[(2-oxo-1,3-dihydroindol-3-yl)methyl]-3-phenylquinazolin-4-one.
Molecular Properties
| Compound Name | 2-[(2-oxo-1,3-dihydroindol-3-yl)methyl]-3-phenylquinazolin-4-one |
| PubChem CID | 4519951 |
| Molecular Formula | C23H17N3O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-[(2-oxo-1,3-dihydroindol-3-yl)methyl]-3-phenylquinazolin-4-one |
| SMILES | O=C1Nc2ccccc2C1Cc1nc2ccccc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C23H17N3O2/c27-22-18(16-10-4-6-12-19(16)25-22)14-21-24-20-13-7-5-11-17(20)23(28)26(21)15-8-2-1-3-9-15/h1-13,18H,14H2,(H,25,27) |
| InChIKey | QIAMVYAWUXHATM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2-oxo-1,3-dihydroindol-3-yl)methyl]-3-phenylquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-oxo-1,3-dihydroindol-3-yl)methyl]-3-phenylquinazolin-4-one?
The IUPAC name of 2-[(2-oxo-1,3-dihydroindol-3-yl)methyl]-3-phenylquinazolin-4-one (CID 4519951) is 2-[(2-oxo-1,3-dihydroindol-3-yl)methyl]-3-phenylquinazolin-4-one.
What is the SMILES notation for 2-[(2-oxo-1,3-dihydroindol-3-yl)methyl]-3-phenylquinazolin-4-one?
The canonical SMILES for 2-[(2-oxo-1,3-dihydroindol-3-yl)methyl]-3-phenylquinazolin-4-one is O=C1Nc2ccccc2C1Cc1nc2ccccc2c(=O)n1-c1ccccc1.
What is the InChIKey of 2-[(2-oxo-1,3-dihydroindol-3-yl)methyl]-3-phenylquinazolin-4-one?
The InChIKey is QIAMVYAWUXHATM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N3O2/c27-22-18(16-10-4-6-12-19(16)25-22)14-21-24-20-13-7-5-11-17(20)23(28)26(21)15-8-2-1-3-9-15/h1-13,18H,14H2,(H,25,27).
What are the key properties of 2-[(2-oxo-1,3-dihydroindol-3-yl)methyl]-3-phenylquinazolin-4-one?
2-[(2-oxo-1,3-dihydroindol-3-yl)methyl]-3-phenylquinazolin-4-one has a molecular weight of 367.41 g/mol, XLogP of 3.66, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-oxo-1,3-dihydroindol-3-yl)methyl]-3-phenylquinazolin-4-one is sourced from PubChem (CID 4519951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).