C23H36N2O2 — CID 45199823
5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-(cyclohexylmethyl)piperidin-2-one (PubChem CID 45199823) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is 5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-(cyclohexylmethyl)piperidin-2-one.
| Compound Name | 5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-(cyclohexylmethyl)piperidin-2-one |
|---|---|
| PubChem CID | 45199823 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | 5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-(cyclohexylmethyl)piperidin-2-one |
| SMILES | C=CCC1(CC=C)CCCN1C(=O)C1CCC(=O)N(CC2CCCCC2)C1 |
| InChI | InChI=1S/C23H36N2O2/c1-3-13-23(14-4-2)15-8-16-25(23)22(27)20-11-12-21(26)24(18-20)17-19-9-6-5-7-10-19/h3-4,19-20H,1-2,5-18H2 |
| InChIKey | GZQKUIYIFOFVHO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|