About 5-piperidin-1-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)pyridazin-3-one
5-piperidin-1-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)pyridazin-3-one (PubChem CID 45200136) has the molecular formula C12H16F3N3O2
and a molecular weight of 291.27 g/mol. Its IUPAC name is 5-piperidin-1-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)pyridazin-3-one.
Molecular Properties
| Compound Name | 5-piperidin-1-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)pyridazin-3-one |
| PubChem CID | 45200136 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 5-piperidin-1-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)pyridazin-3-one |
| SMILES | O=c1cc(N2CCCCC2)cnn1CC(O)C(F)(F)F |
| InChI | InChI=1S/C12H16F3N3O2/c13-12(14,15)10(19)8-18-11(20)6-9(7-16-18)17-4-2-1-3-5-17/h6-7,10,19H,1-5,8H2 |
| InChIKey | RVWDIJCIYJEJEH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-piperidin-1-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-piperidin-1-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)pyridazin-3-one?
The IUPAC name of 5-piperidin-1-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)pyridazin-3-one (CID 45200136) is 5-piperidin-1-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)pyridazin-3-one.
What is the SMILES notation for 5-piperidin-1-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)pyridazin-3-one?
The canonical SMILES for 5-piperidin-1-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)pyridazin-3-one is O=c1cc(N2CCCCC2)cnn1CC(O)C(F)(F)F.
What is the InChIKey of 5-piperidin-1-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)pyridazin-3-one?
The InChIKey is RVWDIJCIYJEJEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3N3O2/c13-12(14,15)10(19)8-18-11(20)6-9(7-16-18)17-4-2-1-3-5-17/h6-7,10,19H,1-5,8H2.
What are the key properties of 5-piperidin-1-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)pyridazin-3-one?
5-piperidin-1-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)pyridazin-3-one has a molecular weight of 291.27 g/mol, XLogP of 1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-piperidin-1-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)pyridazin-3-one is sourced from PubChem (CID 45200136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).