C20H38N4O3 — CID 45201020
2-[1-(3-methylbutyl)-3-oxopiperazin-2-yl]-N-(5-morpholin-4-ylpentyl)acetamide (PubChem CID 45201020) has the molecular formula C20H38N4O3 and a molecular weight of 382.55 g/mol. Its IUPAC name is 2-[1-(3-methylbutyl)-3-oxopiperazin-2-yl]-N-(5-morpholin-4-ylpentyl)acetamide.
| Compound Name | 2-[1-(3-methylbutyl)-3-oxopiperazin-2-yl]-N-(5-morpholin-4-ylpentyl)acetamide |
|---|---|
| PubChem CID | 45201020 |
| Molecular Formula | C20H38N4O3 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | 2-[1-(3-methylbutyl)-3-oxopiperazin-2-yl]-N-(5-morpholin-4-ylpentyl)acetamide |
| SMILES | CC(C)CCN1CCNC(=O)C1CC(=O)NCCCCCN1CCOCC1 |
| InChI | InChI=1S/C20H38N4O3/c1-17(2)6-10-24-11-8-22-20(26)18(24)16-19(25)21-7-4-3-5-9-23-12-14-27-15-13-23/h17-18H,3-16H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | LNGMQUDRMMDARV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|