C23H34FN3O2S — CID 45201774
5-[(3-fluorophenyl)methyl]-3-(2-methylpropyl)-5-[1-(3-methylsulfanylpropyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 45201774) has the molecular formula C23H34FN3O2S and a molecular weight of 435.61 g/mol. Its IUPAC name is 5-[(3-fluorophenyl)methyl]-3-(2-methylpropyl)-5-[1-(3-methylsulfanylpropyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 5-[(3-fluorophenyl)methyl]-3-(2-methylpropyl)-5-[1-(3-methylsulfanylpropyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45201774 |
| Molecular Formula | C23H34FN3O2S |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 5-[(3-fluorophenyl)methyl]-3-(2-methylpropyl)-5-[1-(3-methylsulfanylpropyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CSCCCN1CCC(C2(Cc3cccc(F)c3)NC(=O)N(CC(C)C)C2=O)CC1 |
| InChI | InChI=1S/C23H34FN3O2S/c1-17(2)16-27-21(28)23(25-22(27)29,15-18-6-4-7-20(24)14-18)19-8-11-26(12-9-19)10-5-13-30-3/h4,6-7,14,17,19H,5,8-13,15-16H2,1-3H3,(H,25,29) |
| InChIKey | GEIATZWXLDREKB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|