About N-methyl-2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]-N-(oxolan-3-yl)acetamide
N-methyl-2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]-N-(oxolan-3-yl)acetamide (PubChem CID 45202307) has the molecular formula C24H26N2O4
and a molecular weight of 406.48 g/mol. Its IUPAC name is N-methyl-2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]-N-(oxolan-3-yl)acetamide.
Molecular Properties
| Compound Name | N-methyl-2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]-N-(oxolan-3-yl)acetamide |
| PubChem CID | 45202307 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N-methyl-2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]-N-(oxolan-3-yl)acetamide |
| SMILES | CN1C(=O)CC(CC(=O)N(C)C2CCOC2)(c2ccc(-c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C24H26N2O4/c1-25(20-12-13-30-16-20)21(27)14-24(15-22(28)26(2)23(24)29)19-10-8-18(9-11-19)17-6-4-3-5-7-17/h3-11,20H,12-16H2,1-2H3 |
| InChIKey | PBDJAXKGTOQPCA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]-N-(oxolan-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]-N-(oxolan-3-yl)acetamide?
The IUPAC name of N-methyl-2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]-N-(oxolan-3-yl)acetamide (CID 45202307) is N-methyl-2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]-N-(oxolan-3-yl)acetamide.
What is the SMILES notation for N-methyl-2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]-N-(oxolan-3-yl)acetamide?
The canonical SMILES for N-methyl-2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]-N-(oxolan-3-yl)acetamide is CN1C(=O)CC(CC(=O)N(C)C2CCOC2)(c2ccc(-c3ccccc3)cc2)C1=O.
What is the InChIKey of N-methyl-2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]-N-(oxolan-3-yl)acetamide?
The InChIKey is PBDJAXKGTOQPCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N2O4/c1-25(20-12-13-30-16-20)21(27)14-24(15-22(28)26(2)23(24)29)19-10-8-18(9-11-19)17-6-4-3-5-7-17/h3-11,20H,12-16H2,1-2H3.
What are the key properties of N-methyl-2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]-N-(oxolan-3-yl)acetamide?
N-methyl-2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]-N-(oxolan-3-yl)acetamide has a molecular weight of 406.48 g/mol, XLogP of 2.62, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]-N-(oxolan-3-yl)acetamide is sourced from PubChem (CID 45202307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).