C20H27F2N3O — CID 45202534
3-[1-[(2,3-difluorophenyl)methyl]piperidin-4-yl]-N-prop-2-enylpyrrolidine-1-carboxamide (PubChem CID 45202534) has the molecular formula C20H27F2N3O and a molecular weight of 363.45 g/mol. Its IUPAC name is 3-[1-[(2,3-difluorophenyl)methyl]piperidin-4-yl]-N-prop-2-enylpyrrolidine-1-carboxamide.
| Compound Name | 3-[1-[(2,3-difluorophenyl)methyl]piperidin-4-yl]-N-prop-2-enylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 45202534 |
| Molecular Formula | C20H27F2N3O |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 3-[1-[(2,3-difluorophenyl)methyl]piperidin-4-yl]-N-prop-2-enylpyrrolidine-1-carboxamide |
| SMILES | C=CCNC(=O)N1CCC(C2CCN(Cc3cccc(F)c3F)CC2)C1 |
| InChI | InChI=1S/C20H27F2N3O/c1-2-9-23-20(26)25-12-8-16(14-25)15-6-10-24(11-7-15)13-17-4-3-5-18(21)19(17)22/h2-5,15-16H,1,6-14H2,(H,23,26) |
| InChIKey | OPTJJDWJMYMEIM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|