C18H24N4O2S2 — CID 45202930
5-[1-(2-methylsulfanylacetyl)pyrrolidin-2-yl]-N-(3-pyrazol-1-ylpropyl)thiophene-2-carboxamide (PubChem CID 45202930) has the molecular formula C18H24N4O2S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 5-[1-(2-methylsulfanylacetyl)pyrrolidin-2-yl]-N-(3-pyrazol-1-ylpropyl)thiophene-2-carboxamide.
| Compound Name | 5-[1-(2-methylsulfanylacetyl)pyrrolidin-2-yl]-N-(3-pyrazol-1-ylpropyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 45202930 |
| Molecular Formula | C18H24N4O2S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 5-[1-(2-methylsulfanylacetyl)pyrrolidin-2-yl]-N-(3-pyrazol-1-ylpropyl)thiophene-2-carboxamide |
| SMILES | CSCC(=O)N1CCCC1c1ccc(C(=O)NCCCn2cccn2)s1 |
| InChI | InChI=1S/C18H24N4O2S2/c1-25-13-17(23)22-12-2-5-14(22)15-6-7-16(26-15)18(24)19-8-3-10-21-11-4-9-20-21/h4,6-7,9,11,14H,2-3,5,8,10,12-13H2,1H3,(H,19,24) |
| InChIKey | CVGGDMXZBGZWCQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|