About 3-(3-chloro-1,2-oxazol-5-yl)-N-(thiolan-3-yl)propanamide
3-(3-chloro-1,2-oxazol-5-yl)-N-(thiolan-3-yl)propanamide (PubChem CID 45203025) has the molecular formula C10H13ClN2O2S
and a molecular weight of 260.75 g/mol. Its IUPAC name is 3-(3-chloro-1,2-oxazol-5-yl)-N-(thiolan-3-yl)propanamide.
Molecular Properties
| Compound Name | 3-(3-chloro-1,2-oxazol-5-yl)-N-(thiolan-3-yl)propanamide |
| PubChem CID | 45203025 |
| Molecular Formula | C10H13ClN2O2S |
| Molecular Weight | 260.75 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 3-(3-chloro-1,2-oxazol-5-yl)-N-(thiolan-3-yl)propanamide |
| SMILES | O=C(CCc1cc(Cl)no1)NC1CCSC1 |
| InChI | InChI=1S/C10H13ClN2O2S/c11-9-5-8(15-13-9)1-2-10(14)12-7-3-4-16-6-7/h5,7H,1-4,6H2,(H,12,14) |
| InChIKey | NDUXERGZLUUWDR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.75 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-chloro-1,2-oxazol-5-yl)-N-(thiolan-3-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chloro-1,2-oxazol-5-yl)-N-(thiolan-3-yl)propanamide?
The IUPAC name of 3-(3-chloro-1,2-oxazol-5-yl)-N-(thiolan-3-yl)propanamide (CID 45203025) is 3-(3-chloro-1,2-oxazol-5-yl)-N-(thiolan-3-yl)propanamide.
What is the SMILES notation for 3-(3-chloro-1,2-oxazol-5-yl)-N-(thiolan-3-yl)propanamide?
The canonical SMILES for 3-(3-chloro-1,2-oxazol-5-yl)-N-(thiolan-3-yl)propanamide is O=C(CCc1cc(Cl)no1)NC1CCSC1.
What is the InChIKey of 3-(3-chloro-1,2-oxazol-5-yl)-N-(thiolan-3-yl)propanamide?
The InChIKey is NDUXERGZLUUWDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN2O2S/c11-9-5-8(15-13-9)1-2-10(14)12-7-3-4-16-6-7/h5,7H,1-4,6H2,(H,12,14).
What are the key properties of 3-(3-chloro-1,2-oxazol-5-yl)-N-(thiolan-3-yl)propanamide?
3-(3-chloro-1,2-oxazol-5-yl)-N-(thiolan-3-yl)propanamide has a molecular weight of 260.75 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chloro-1,2-oxazol-5-yl)-N-(thiolan-3-yl)propanamide is sourced from PubChem (CID 45203025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).