C20H29N3O4 — CID 45203710
N-(4-hydroxycyclohexyl)-2-[1-[(2-methoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide (PubChem CID 45203710) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-(4-hydroxycyclohexyl)-2-[1-[(2-methoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide.
| Compound Name | N-(4-hydroxycyclohexyl)-2-[1-[(2-methoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 45203710 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | N-(4-hydroxycyclohexyl)-2-[1-[(2-methoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide |
| SMILES | COc1ccccc1CN1CCNC(=O)C1CC(=O)NC1CCC(O)CC1 |
| InChI | InChI=1S/C20H29N3O4/c1-27-18-5-3-2-4-14(18)13-23-11-10-21-20(26)17(23)12-19(25)22-15-6-8-16(24)9-7-15/h2-5,15-17,24H,6-13H2,1H3,(H,21,26)(H,22,25) |
| InChIKey | AIRLEQWXAYMELI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |