About 4-N-[1-(cyclohexylmethyl)piperidin-3-yl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide
4-N-[1-(cyclohexylmethyl)piperidin-3-yl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide (PubChem CID 45203935) has the molecular formula C21H38N4O2
and a molecular weight of 378.56 g/mol. Its IUPAC name is 4-N-[1-(cyclohexylmethyl)piperidin-3-yl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 4-N-[1-(cyclohexylmethyl)piperidin-3-yl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide |
| PubChem CID | 45203935 |
| Molecular Formula | C21H38N4O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | 4-N-[1-(cyclohexylmethyl)piperidin-3-yl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide |
| SMILES | CN(C)C(=O)N1CCC(C(=O)NC2CCCN(CC3CCCCC3)C2)CC1 |
| InChI | InChI=1S/C21H38N4O2/c1-23(2)21(27)25-13-10-18(11-14-25)20(26)22-19-9-6-12-24(16-19)15-17-7-4-3-5-8-17/h17-19H,3-16H2,1-2H3,(H,22,26) |
| InChIKey | NTASZSHQWBVGBL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-N-[1-(cyclohexylmethyl)piperidin-3-yl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[1-(cyclohexylmethyl)piperidin-3-yl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide?
The IUPAC name of 4-N-[1-(cyclohexylmethyl)piperidin-3-yl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide (CID 45203935) is 4-N-[1-(cyclohexylmethyl)piperidin-3-yl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide.
What is the SMILES notation for 4-N-[1-(cyclohexylmethyl)piperidin-3-yl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide?
The canonical SMILES for 4-N-[1-(cyclohexylmethyl)piperidin-3-yl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide is CN(C)C(=O)N1CCC(C(=O)NC2CCCN(CC3CCCCC3)C2)CC1.
What is the InChIKey of 4-N-[1-(cyclohexylmethyl)piperidin-3-yl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide?
The InChIKey is NTASZSHQWBVGBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38N4O2/c1-23(2)21(27)25-13-10-18(11-14-25)20(26)22-19-9-6-12-24(16-19)15-17-7-4-3-5-8-17/h17-19H,3-16H2,1-2H3,(H,22,26).
What are the key properties of 4-N-[1-(cyclohexylmethyl)piperidin-3-yl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide?
4-N-[1-(cyclohexylmethyl)piperidin-3-yl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide has a molecular weight of 378.56 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[1-(cyclohexylmethyl)piperidin-3-yl]-1-N,1-N-dimethylpiperidine-1,4-dicarboxamide is sourced from PubChem (CID 45203935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).