C20H13NO4S — CID 4520522
N-[2-[(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)sulfanyl]phenyl]acetamide (PubChem CID 4520522) has the molecular formula C20H13NO4S and a molecular weight of 363.39 g/mol. Its IUPAC name is N-[2-[(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)sulfanyl]phenyl]acetamide.
| Compound Name | N-[2-[(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)sulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 4520522 |
| Molecular Formula | C20H13NO4S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | N-[2-[(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)sulfanyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1Sc1ccc2c3c(cccc13)C(=O)OC2=O |
| InChI | InChI=1S/C20H13NO4S/c1-11(22)21-15-7-2-3-8-17(15)26-16-10-9-14-18-12(16)5-4-6-13(18)19(23)25-20(14)24/h2-10H,1H3,(H,21,22) |
| InChIKey | XZGBLFZKWLZDPF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|