C15H20N2S2 — CID 4520524
1-[(5-methylthiophen-2-yl)-thiophen-2-ylmethyl]-1,4-diazepane (PubChem CID 4520524) has the molecular formula C15H20N2S2 and a molecular weight of 292.47 g/mol. Its IUPAC name is 1-[(5-methylthiophen-2-yl)-thiophen-2-ylmethyl]-1,4-diazepane.
| Compound Name | 1-[(5-methylthiophen-2-yl)-thiophen-2-ylmethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 4520524 |
| Molecular Formula | C15H20N2S2 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-[(5-methylthiophen-2-yl)-thiophen-2-ylmethyl]-1,4-diazepane |
| SMILES | Cc1ccc(C(c2cccs2)N2CCCNCC2)s1 |
| InChI | InChI=1S/C15H20N2S2/c1-12-5-6-14(19-12)15(13-4-2-11-18-13)17-9-3-7-16-8-10-17/h2,4-6,11,15-16H,3,7-10H2,1H3 |
| InChIKey | NUQDLYTXNSPJJD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |