C29H36N2O2 — CID 45205428
(E)-N-[[1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl]methyl]-N-(oxolan-2-ylmethyl)-3-phenylprop-2-enamide (PubChem CID 45205428) has the molecular formula C29H36N2O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is (E)-N-[[1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl]methyl]-N-(oxolan-2-ylmethyl)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[[1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl]methyl]-N-(oxolan-2-ylmethyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 45205428 |
| Molecular Formula | C29H36N2O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | (E)-N-[[1-(2,3-dihydro-1H-inden-2-yl)piperidin-4-yl]methyl]-N-(oxolan-2-ylmethyl)-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N(CC1CCN(C2Cc3ccccc3C2)CC1)CC1CCCO1 |
| InChI | InChI=1S/C29H36N2O2/c32-29(13-12-23-7-2-1-3-8-23)31(22-28-11-6-18-33-28)21-24-14-16-30(17-15-24)27-19-25-9-4-5-10-26(25)20-27/h1-5,7-10,12-13,24,27-28H,6,11,14-22H2/b13-12+ |
| InChIKey | DPHJXKQMSVYHJX-OUKQBFOZSA-N |
| XLogP | 4.59 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|