About 2-methyl-6-[3-(2-phenylethyl)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one
2-methyl-6-[3-(2-phenylethyl)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one (PubChem CID 45205478) has the molecular formula C19H25N3O2
and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-methyl-6-[3-(2-phenylethyl)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one.
Molecular Properties
| Compound Name | 2-methyl-6-[3-(2-phenylethyl)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one |
| PubChem CID | 45205478 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 2-methyl-6-[3-(2-phenylethyl)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one |
| SMILES | CN1N=C(C(=O)N2CCCC(CCc3ccccc3)C2)CCC1=O |
| InChI | InChI=1S/C19H25N3O2/c1-21-18(23)12-11-17(20-21)19(24)22-13-5-8-16(14-22)10-9-15-6-3-2-4-7-15/h2-4,6-7,16H,5,8-14H2,1H3 |
| InChIKey | ZLBDRATWDOVKFA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-6-[3-(2-phenylethyl)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-[3-(2-phenylethyl)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one?
The IUPAC name of 2-methyl-6-[3-(2-phenylethyl)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one (CID 45205478) is 2-methyl-6-[3-(2-phenylethyl)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one.
What is the SMILES notation for 2-methyl-6-[3-(2-phenylethyl)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one?
The canonical SMILES for 2-methyl-6-[3-(2-phenylethyl)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one is CN1N=C(C(=O)N2CCCC(CCc3ccccc3)C2)CCC1=O.
What is the InChIKey of 2-methyl-6-[3-(2-phenylethyl)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one?
The InChIKey is ZLBDRATWDOVKFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3O2/c1-21-18(23)12-11-17(20-21)19(24)22-13-5-8-16(14-22)10-9-15-6-3-2-4-7-15/h2-4,6-7,16H,5,8-14H2,1H3.
What are the key properties of 2-methyl-6-[3-(2-phenylethyl)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one?
2-methyl-6-[3-(2-phenylethyl)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one has a molecular weight of 327.43 g/mol, XLogP of 2.47, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-[3-(2-phenylethyl)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one is sourced from PubChem (CID 45205478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).