C18H22N2O2 — CID 45205610
2-(4-ethenylbenzoyl)-7-methyl-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 45205610) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-(4-ethenylbenzoyl)-7-methyl-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | 2-(4-ethenylbenzoyl)-7-methyl-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 45205610 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2-(4-ethenylbenzoyl)-7-methyl-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | C=Cc1ccc(C(=O)N2CCC3(CCCN(C)C3=O)C2)cc1 |
| InChI | InChI=1S/C18H22N2O2/c1-3-14-5-7-15(8-6-14)16(21)20-12-10-18(13-20)9-4-11-19(2)17(18)22/h3,5-8H,1,4,9-13H2,2H3 |
| InChIKey | SWHDNTDBDHRKJS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |