C26H37N3O2 — CID 45206216
2-[4-[1-(3-methoxyphenyl)piperidin-4-yl]-1-(2-phenylethyl)piperazin-2-yl]ethanol (PubChem CID 45206216) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is 2-[4-[1-(3-methoxyphenyl)piperidin-4-yl]-1-(2-phenylethyl)piperazin-2-yl]ethanol.
| Compound Name | 2-[4-[1-(3-methoxyphenyl)piperidin-4-yl]-1-(2-phenylethyl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 45206216 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | 2-[4-[1-(3-methoxyphenyl)piperidin-4-yl]-1-(2-phenylethyl)piperazin-2-yl]ethanol |
| SMILES | COc1cccc(N2CCC(N3CCN(CCc4ccccc4)C(CCO)C3)CC2)c1 |
| InChI | InChI=1S/C26H37N3O2/c1-31-26-9-5-8-24(20-26)27-15-11-23(12-16-27)29-18-17-28(25(21-29)13-19-30)14-10-22-6-3-2-4-7-22/h2-9,20,23,25,30H,10-19,21H2,1H3 |
| InChIKey | RTLBXEILTLGVTR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |