C25H41N3O — CID 45206280
2-[4-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-1-(3-methylbutyl)piperazin-2-yl]ethanol (PubChem CID 45206280) has the molecular formula C25H41N3O and a molecular weight of 399.62 g/mol. Its IUPAC name is 2-[4-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-1-(3-methylbutyl)piperazin-2-yl]ethanol.
| Compound Name | 2-[4-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-1-(3-methylbutyl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 45206280 |
| Molecular Formula | C25H41N3O |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.32 |
| IUPAC Name | 2-[4-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-1-(3-methylbutyl)piperazin-2-yl]ethanol |
| SMILES | CC(C)CCN1CCN(C2CCN(c3ccc4c(c3)CCC4)CC2)CC1CCO |
| InChI | InChI=1S/C25H41N3O/c1-20(2)8-12-27-15-16-28(19-25(27)11-17-29)23-9-13-26(14-10-23)24-7-6-21-4-3-5-22(21)18-24/h6-7,18,20,23,25,29H,3-5,8-17,19H2,1-2H3 |
| InChIKey | ADYJNYLZXCLFKC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|