C21H24N4O3S — CID 45207313
N-[1-[2-oxo-2-(1-thiophen-2-ylpropan-2-ylamino)ethyl]pyrazol-4-yl]-3-phenoxypropanamide (PubChem CID 45207313) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is N-[1-[2-oxo-2-(1-thiophen-2-ylpropan-2-ylamino)ethyl]pyrazol-4-yl]-3-phenoxypropanamide.
| Compound Name | N-[1-[2-oxo-2-(1-thiophen-2-ylpropan-2-ylamino)ethyl]pyrazol-4-yl]-3-phenoxypropanamide |
|---|---|
| PubChem CID | 45207313 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[1-[2-oxo-2-(1-thiophen-2-ylpropan-2-ylamino)ethyl]pyrazol-4-yl]-3-phenoxypropanamide |
| SMILES | CC(Cc1cccs1)NC(=O)Cn1cc(NC(=O)CCOc2ccccc2)cn1 |
| InChI | InChI=1S/C21H24N4O3S/c1-16(12-19-8-5-11-29-19)23-21(27)15-25-14-17(13-22-25)24-20(26)9-10-28-18-6-3-2-4-7-18/h2-8,11,13-14,16H,9-10,12,15H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | OCZNLGOOEFTENE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |