C28H28N4O — CID 45207664
[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-[3-(5-phenyl-2-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]methanone (PubChem CID 45207664) has the molecular formula C28H28N4O and a molecular weight of 436.56 g/mol. Its IUPAC name is [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-[3-(5-phenyl-2-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]methanone.
| Compound Name | [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-[3-(5-phenyl-2-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 45207664 |
| Molecular Formula | C28H28N4O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]-[3-(5-phenyl-2-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]methanone |
| SMILES | O=C([C@H]1C[C@@H]2C=C[C@H]1C2)N1CCCC(c2nc(-c3ccncc3)ncc2-c2ccccc2)C1 |
| InChI | InChI=1S/C28H28N4O/c33-28(24-16-19-8-9-22(24)15-19)32-14-4-7-23(18-32)26-25(20-5-2-1-3-6-20)17-30-27(31-26)21-10-12-29-13-11-21/h1-3,5-6,8-13,17,19,22-24H,4,7,14-16,18H2/t19-,22+,23?,24+/m1/s1 |
| InChIKey | JRHMFFXXNDFRST-WHKDDAHASA-N |
| XLogP | 5.12 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|