C23H29N3O2S — CID 45207854
pyridin-3-yl-[3-[[4-(thiomorpholin-4-ylmethyl)phenoxy]methyl]piperidin-1-yl]methanone (PubChem CID 45207854) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is pyridin-3-yl-[3-[[4-(thiomorpholin-4-ylmethyl)phenoxy]methyl]piperidin-1-yl]methanone.
| Compound Name | pyridin-3-yl-[3-[[4-(thiomorpholin-4-ylmethyl)phenoxy]methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 45207854 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | pyridin-3-yl-[3-[[4-(thiomorpholin-4-ylmethyl)phenoxy]methyl]piperidin-1-yl]methanone |
| SMILES | O=C(c1cccnc1)N1CCCC(COc2ccc(CN3CCSCC3)cc2)C1 |
| InChI | InChI=1S/C23H29N3O2S/c27-23(21-4-1-9-24-15-21)26-10-2-3-20(17-26)18-28-22-7-5-19(6-8-22)16-25-11-13-29-14-12-25/h1,4-9,15,20H,2-3,10-14,16-18H2 |
| InChIKey | RKYDHJRRZYHSQG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |