C25H19N5O9 — CID 4520790
[1,3-bis(4-nitrobenzoyl)-1,3-diazinan-5-yl]-(4-nitrophenyl)methanone (PubChem CID 4520790) has the molecular formula C25H19N5O9 and a molecular weight of 533.45 g/mol. Its IUPAC name is [1,3-bis(4-nitrobenzoyl)-1,3-diazinan-5-yl]-(4-nitrophenyl)methanone.
| Compound Name | [1,3-bis(4-nitrobenzoyl)-1,3-diazinan-5-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 4520790 |
| Molecular Formula | C25H19N5O9 |
| Molecular Weight | 533.45 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | [1,3-bis(4-nitrobenzoyl)-1,3-diazinan-5-yl]-(4-nitrophenyl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)C1CN(C(=O)c2ccc([N+](=O)[O-])cc2)CN(C(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C25H19N5O9/c31-23(16-1-7-20(8-2-16)28(34)35)19-13-26(24(32)17-3-9-21(10-4-17)29(36)37)15-27(14-19)25(33)18-5-11-22(12-6-18)30(38)39/h1-12,19H,13-15H2 |
| InChIKey | JUARVQCLQVFNNW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 187.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|