C10H10N2O2S — CID 45208254
5-(oxolan-2-yl)-3-thiophen-3-yl-1,2,4-oxadiazole (PubChem CID 45208254) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is 5-(oxolan-2-yl)-3-thiophen-3-yl-1,2,4-oxadiazole.
| Compound Name | 5-(oxolan-2-yl)-3-thiophen-3-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 45208254 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 5-(oxolan-2-yl)-3-thiophen-3-yl-1,2,4-oxadiazole |
| SMILES | c1cc(-c2noc(C3CCCO3)n2)cs1 |
| InChI | InChI=1S/C10H10N2O2S/c1-2-8(13-4-1)10-11-9(12-14-10)7-3-5-15-6-7/h3,5-6,8H,1-2,4H2 |
| InChIKey | IOTPZZNTZZPLKQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |