C22H27N5O4 — CID 45208455
N-[1-[7-[(2,3-dimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]furan-2-carboxamide (PubChem CID 45208455) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[1-[7-[(2,3-dimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]furan-2-carboxamide.
| Compound Name | N-[1-[7-[(2,3-dimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 45208455 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[1-[7-[(2,3-dimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]furan-2-carboxamide |
| SMILES | COc1cccc(CN2CCc3nnc(C(C)NC(=O)c4ccco4)n3CC2)c1OC |
| InChI | InChI=1S/C22H27N5O4/c1-15(23-22(28)18-8-5-13-31-18)21-25-24-19-9-10-26(11-12-27(19)21)14-16-6-4-7-17(29-2)20(16)30-3/h4-8,13,15H,9-12,14H2,1-3H3,(H,23,28) |
| InChIKey | LDVSXLVHXIIKSZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |