C19H25N5O3 — CID 45209170
5-(dimethylamino)-2-[2-oxo-2-[3-(pyridin-2-ylmethoxy)piperidin-1-yl]ethyl]pyridazin-3-one (PubChem CID 45209170) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 5-(dimethylamino)-2-[2-oxo-2-[3-(pyridin-2-ylmethoxy)piperidin-1-yl]ethyl]pyridazin-3-one.
| Compound Name | 5-(dimethylamino)-2-[2-oxo-2-[3-(pyridin-2-ylmethoxy)piperidin-1-yl]ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 45209170 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 5-(dimethylamino)-2-[2-oxo-2-[3-(pyridin-2-ylmethoxy)piperidin-1-yl]ethyl]pyridazin-3-one |
| SMILES | CN(C)c1cnn(CC(=O)N2CCCC(OCc3ccccn3)C2)c(=O)c1 |
| InChI | InChI=1S/C19H25N5O3/c1-22(2)16-10-18(25)24(21-11-16)13-19(26)23-9-5-7-17(12-23)27-14-15-6-3-4-8-20-15/h3-4,6,8,10-11,17H,5,7,9,12-14H2,1-2H3 |
| InChIKey | OZYKUXXPUGVKGC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |