C23H19FN2O3S — CID 45209293
(E)-N-[[7-(5-acetylthiophen-2-yl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 45209293) has the molecular formula C23H19FN2O3S and a molecular weight of 422.48 g/mol. Its IUPAC name is (E)-N-[[7-(5-acetylthiophen-2-yl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[[7-(5-acetylthiophen-2-yl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 45209293 |
| Molecular Formula | C23H19FN2O3S |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | (E)-N-[[7-(5-acetylthiophen-2-yl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | CC(=O)c1ccc(-c2cc(F)cc3c2OC(CNC(=O)/C=C/c2cccnc2)C3)s1 |
| InChI | InChI=1S/C23H19FN2O3S/c1-14(27)20-5-6-21(30-20)19-11-17(24)9-16-10-18(29-23(16)19)13-26-22(28)7-4-15-3-2-8-25-12-15/h2-9,11-12,18H,10,13H2,1H3,(H,26,28)/b7-4+ |
| InChIKey | OONLKWSFLNRDCW-QPJJXVBHSA-N |
| XLogP | 4.28 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|