C36H33N3O5 — CID 45209347
1-[2-(1,3-benzodioxol-5-ylmethyl)-1,3-dioxoisoindol-4-yl]-N-(2,2-diphenylethyl)piperidine-4-carboxamide (PubChem CID 45209347) has the molecular formula C36H33N3O5 and a molecular weight of 587.68 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-ylmethyl)-1,3-dioxoisoindol-4-yl]-N-(2,2-diphenylethyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-ylmethyl)-1,3-dioxoisoindol-4-yl]-N-(2,2-diphenylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45209347 |
| Molecular Formula | C36H33N3O5 |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-ylmethyl)-1,3-dioxoisoindol-4-yl]-N-(2,2-diphenylethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCC(c1ccccc1)c1ccccc1)C1CCN(c2cccc3c2C(=O)N(Cc2ccc4c(c2)OCO4)C3=O)CC1 |
| InChI | InChI=1S/C36H33N3O5/c40-34(37-21-29(25-8-3-1-4-9-25)26-10-5-2-6-11-26)27-16-18-38(19-17-27)30-13-7-12-28-33(30)36(42)39(35(28)41)22-24-14-15-31-32(20-24)44-23-43-31/h1-15,20,27,29H,16-19,21-23H2,(H,37,40) |
| InChIKey | JRRKZWISYGVAPX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|