C22H27N3O3 — CID 45210720
cycloheptyl-[3-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methanone (PubChem CID 45210720) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is cycloheptyl-[3-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methanone.
| Compound Name | cycloheptyl-[3-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 45210720 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | cycloheptyl-[3-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methanone |
| SMILES | O=C(C1CCCCCC1)N1CCc2[nH]nc(C3COc4ccccc4O3)c2C1 |
| InChI | InChI=1S/C22H27N3O3/c26-22(15-7-3-1-2-4-8-15)25-12-11-17-16(13-25)21(24-23-17)20-14-27-18-9-5-6-10-19(18)28-20/h5-6,9-10,15,20H,1-4,7-8,11-14H2,(H,23,24) |
| InChIKey | NIJMVFYXUDOKHE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |