C25H23N3O3 — CID 45211848
1-(furan-2-carbonyl)-N-[3-(1H-indol-2-yl)phenyl]piperidine-3-carboxamide (PubChem CID 45211848) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 1-(furan-2-carbonyl)-N-[3-(1H-indol-2-yl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-(furan-2-carbonyl)-N-[3-(1H-indol-2-yl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45211848 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 1-(furan-2-carbonyl)-N-[3-(1H-indol-2-yl)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(-c2cc3ccccc3[nH]2)c1)C1CCCN(C(=O)c2ccco2)C1 |
| InChI | InChI=1S/C25H23N3O3/c29-24(19-8-4-12-28(16-19)25(30)23-11-5-13-31-23)26-20-9-3-7-17(14-20)22-15-18-6-1-2-10-21(18)27-22/h1-3,5-7,9-11,13-15,19,27H,4,8,12,16H2,(H,26,29) |
| InChIKey | JYZHVQHOPYOTRZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |