C21H26N4O2 — CID 45212022
6-oxo-1-(2-pyridin-2-ylethyl)-N-(3-pyridin-2-ylpropyl)piperidine-3-carboxamide (PubChem CID 45212022) has the molecular formula C21H26N4O2 and a molecular weight of 366.46 g/mol. Its IUPAC name is 6-oxo-1-(2-pyridin-2-ylethyl)-N-(3-pyridin-2-ylpropyl)piperidine-3-carboxamide.
| Compound Name | 6-oxo-1-(2-pyridin-2-ylethyl)-N-(3-pyridin-2-ylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45212022 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 6-oxo-1-(2-pyridin-2-ylethyl)-N-(3-pyridin-2-ylpropyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCCc1ccccn1)C1CCC(=O)N(CCc2ccccn2)C1 |
| InChI | InChI=1S/C21H26N4O2/c26-20-10-9-17(16-25(20)15-11-19-7-2-4-13-23-19)21(27)24-14-5-8-18-6-1-3-12-22-18/h1-4,6-7,12-13,17H,5,8-11,14-16H2,(H,24,27) |
| InChIKey | GHWZEVGWIQZEKE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|